Difference between revisions of "Ec-19 002210"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...")
(Created page with "Category:Gene == Gene Ec-19_002210 == * left end position: ** 2407285 * transcription direction: ** POSITIVE * right end position: ** 2411840 * centisome position: ** 40.3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] ==
+
== Gene Ec-19_002210 ==
−
* smiles:
+
* left end position:
−
** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
+
** 2407285
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** β-L-fucose 1-phosphate
+
** 2411840
−
* molecular weight:
+
* centisome position:
−
** 242.122    
+
** 40.318386    
 
* Synonym(s):
 
* Synonym(s):
−
** L-Fucose 1-phosphate
+
** Esi_0425_0023
−
** 6-deoxy-L-galactose 1-phosphate
+
** Esi0425_0023
−
** L-fucopyranose 1-(dihydrogen phosphate)
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[2.7.7.30-RXN]]
+
* Reaction: [[HEMN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[FUCOKINASE-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5531]]
 +
* [[HEMESYN2-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2407285}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266535 45266535]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2411840}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57268 57268]
+
{{#set: centisome position=40.318386   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0425_0023|Esi0425_0023}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02985 C02985]
+
{{#set: reaction associated=HEMN-RXN}}
−
* HMDB : HMDB01265
+
{{#set: pathway associated=PWY-5531|HEMESYN2-PWY}}
−
{{#set: smiles=CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L}}
+
−
{{#set: common name=β-L-fucose 1-phosphate}}
+
−
{{#set: molecular weight=242.122   }}
+
−
{{#set: common name=L-Fucose 1-phosphate|6-deoxy-L-galactose 1-phosphate|L-fucopyranose 1-(dihydrogen phosphate)}}
+
−
{{#set: consumed by=2.7.7.30-RXN}}
+
−
{{#set: produced by=FUCOKINASE-RXN}}
+

Latest revision as of 19:02, 21 March 2018

Gene Ec-19_002210

  • left end position:
    • 2407285
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2411840
  • centisome position:
    • 40.318386
  • Synonym(s):
    • Esi_0425_0023
    • Esi0425_0023

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_002210&oldid=24070"