Difference between revisions of "CPD-12177"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5936 PWY-5936] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5936 PWY-5936] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CC([CH]=O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
 
* common name:
 
* common name:
** xyloglucan biosynthesis
+
** (R)-methylmalonate-semialdehyde
 +
* molecular weight:
 +
** 101.082   
 
* Synonym(s):
 
* Synonym(s):
 +
** (R)-2-methyl-3-oxopropanoate
 +
** (R)-ch3-malonate-semialdehyde
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''6''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-9463]]
+
== Reaction(s) of unknown directionality ==
** 1 associated gene(s):
+
* [[RXN-14056]]
*** [[Ec-22_001510]]
+
** 1 reconstruction source(s) associated:
+
*** [[annotation-esiliculosus_genome]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12415 RXN-12415]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12418 RXN-12418]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12419 RXN-12419]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9461 RXN-9461]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9462 RXN-9462]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* PUBCHEM:
{{#set: common name=xyloglucan biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
{{#set: reaction found=1}}
+
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
{{#set: total reaction=6}}
+
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
{{#set: completion rate=17.0}}
+
{{#set: common name=(R)-methylmalonate-semialdehyde}}
 +
{{#set: molecular weight=101.082    }}
 +
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
 +
{{#set: reversible reaction associated=RXN-14056}}

Latest revision as of 20:02, 21 March 2018

Metabolite CPD-12177

  • smiles:
    • CC([CH]=O)C(=O)[O-]
  • inchi key:
    • InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
  • common name:
    • (R)-methylmalonate-semialdehyde
  • molecular weight:
    • 101.082
  • Synonym(s):
    • (R)-2-methyl-3-oxopropanoate
    • (R)-ch3-malonate-semialdehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC([CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.