Difference between revisions of "ExchangeSeed MG+2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_MG+2 ExchangeSeed_MG+2] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formu...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_MG+2 ExchangeSeed_MG+2] == |
| − | + | * direction: | |
| − | + | ** REVERSIBLE | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1.0 [[MG+2]][C-BOUNDARY] '''<=>''' 1.0 [[MG+2]][e] | |
| − | == | + | * With common name(s): |
| + | ** 1.0 Mg2+[C-BOUNDARY] '''<=>''' 1.0 Mg2+[e] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[manual]] | ||
| + | ** Source: [[manual-import_from_medium]] | ||
| + | *** Comment: [[added to manage seeds from boundary to extracellular compartment]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=manual}} | |
| − | + | {{#set: reconstruction source=manual-import_from_medium}} | |
| − | + | {{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 19:02, 21 March 2018
Contents
Reaction ExchangeSeed_MG+2
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 Mg2+[C-BOUNDARY] <=> 1.0 Mg2+[e]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual
