Difference between revisions of "CPD1F-97"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 +
* inchi key:
 +
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
 
* common name:
 
* common name:
−
** traumatin and (Z)-3-hexen-1-yl acetate biosynthesis
+
** gibberellin A15 (open lactone form)
 +
* molecular weight:
 +
** 346.422   
 
* Synonym(s):
 
* Synonym(s):
−
** 13-lipoxygenase and 13-hydroperoxide lyase pathway
+
** gibberellin A15
−
** 13-LOX and 13-HPL pathway
+
** GA15
 +
** GA15 (open lactone form)
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''1''' reactions found over '''9''' reactions in the full pathway
+
* [[RXN1F-163]]
−
* [[RXN-1321]]
+
== Reaction(s) known to produce the compound ==
−
** 4 associated gene(s):
+
* [[RXN1F-162]]
−
*** [[Ec-03_000010]]
+
== Reaction(s) of unknown directionality ==
−
*** [[Ec-03_000020]]
+
−
*** [[Ec-20_003620]]
+
−
*** [[Ec-20_003630]]
+
−
** 2 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
*** [[orthology-aragem]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROHEX-RXN HYDROHEX-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=LIPOXYGENASE-RXN LIPOXYGENASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11852 RXN-11852]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12299 RXN-12299]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1345 RXN-1345]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1346 RXN-1346]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1347 RXN-1347]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1349 RXN-1349]
+
 
== External links  ==
 
== External links  ==
−
* ARACYC:
+
* LIPID_MAPS : LMPR0104170017
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5410 PWY-5410]
+
* PUBCHEM:
−
{{#set: taxonomic range=TAX-3193}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
−
{{#set: common name=traumatin and (Z)-3-hexen-1-yl acetate biosynthesis}}
+
* CHEBI:
−
{{#set: common name=13-lipoxygenase and 13-hydroperoxide lyase pathway|13-LOX and 13-HPL pathway}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
−
{{#set: reaction found=1}}
+
* LIGAND-CPD:
−
{{#set: total reaction=9}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
−
{{#set: completion rate=11.0}}
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
 +
{{#set: common name=gibberellin A15 (open lactone form)}}
 +
{{#set: molecular weight=346.422    }}
 +
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
 +
{{#set: consumed by=RXN1F-163}}
 +
{{#set: produced by=RXN1F-162}}

Latest revision as of 19:02, 21 March 2018

Metabolite CPD1F-97

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • inchi key:
    • InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
  • common name:
    • gibberellin A15 (open lactone form)
  • molecular weight:
    • 346.422
  • Synonym(s):
    • gibberellin A15
    • GA15
    • GA15 (open lactone form)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD1F-97&oldid=24101"