Difference between revisions of "RXN-17736"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] == * smiles: ** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-] * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17736 RXN-17736] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 * ec numbe...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1086 CPD-1086] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17736 RXN-17736] ==
−
* smiles:
+
* direction:
−
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L
+
 
* common name:
 
* common name:
−
** 5-amino-6-(5-phospho-D-ribitylamino)uracil
+
** phospholipase A2
−
* molecular weight:
+
* ec number:
−
** 354.213   
+
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-6-(5'-phosphoribitylamino)uracil
 
−
** 5-amino-6-(5-phosphoribitylamino)uracil
 
−
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RIBOFLAVINSYNREDUC-RXN]]
+
** 1 [[PLASMENYLCHOLINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Long-Chain-Fatty-Acids]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-563]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a plasmenylcholine[c] '''+''' 1 H2O[c] '''=>''' 1 a long-chain fatty acid[c] '''+''' 1 H+[c] '''+''' 1 a 1-(1-alkenyl)-sn-glycero-3-phosphocholine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_004650]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
* Gene: [[Ec-21_005150]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-7783]], plasmalogen degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7783 PWY-7783]
 +
** '''2''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04454 C04454]
+
{{#set: common name=phospholipase A2}}
−
* CHEBI:
+
{{#set: ec number=EC-3.1.1.4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58421 58421]
+
{{#set: gene associated=Ec-04_004650|Ec-21_005150}}
−
* BIGG : 43851
+
{{#set: in pathway=PWY-7783}}
−
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266638 45266638]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* HMDB : HMDB03841
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=RQRINYISXYAZKL-RPDRRWSUSA-L}}
+
−
{{#set: common name=5-amino-6-(5-phospho-D-ribitylamino)uracil}}
+
−
{{#set: molecular weight=354.213    }}
+
−
{{#set: common name=5-amino-6-(5'-phosphoribitylamino)uracil|5-amino-6-(5-phosphoribitylamino)uracil|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione 5'-phosphate}}
+
−
{{#set: produced by=RIBOFLAVINSYNREDUC-RXN}}
+

Latest revision as of 19:03, 21 March 2018

Reaction RXN-17736

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • phospholipase A2
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7783, plasmalogen degradation: PWY-7783
    • 2 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-17736&oldid=24162"