Difference between revisions of "Ec-07 005240"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * smiles: ** C(=CC1(=CC=C(O)C=C1))CO * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Ec-07_005240 == * left end position: ** 5097069 * transcription direction: ** NEGATIVE * right end position: ** 5108542 * centisome position: ** 66.0...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
+
== Gene Ec-07_005240 ==
−
* smiles:
+
* left end position:
−
** C(=CC1(=CC=C(O)C=C1))CO
+
** 5097069
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 4-coumaryl alcohol
+
** 5108542
−
* molecular weight:
+
* centisome position:
−
** 150.177    
+
** 66.00343    
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaryl alcohol
+
** Esi_0176_0045
 +
** Esi0176_0045
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.2.1.21-RXN]]
−
* [[RXN-1102]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-10769]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10773]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13600]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13602]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13603]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14179]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-5341]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-8036]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-9674]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-3121]]
 +
* [[PWY-6002]]
 +
* [[PWY-6788]]
 +
* [[PWY-5176]]
 +
* [[PWY-7092]]
 +
* [[PWY-7091]]
 +
* [[PWY-7089]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5097069}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280535 5280535]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=5108542}}
−
** [http://www.chemspider.com/Chemical-Structure.4444166.html 4444166]
+
{{#set: centisome position=66.00343   }}
−
* CHEBI:
+
{{#set: common name=Esi_0176_0045|Esi0176_0045}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28386 28386]
+
{{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13600|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091|PWY-7089}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02646 C02646]
+
−
* HMDB : HMDB03654
+
−
{{#set: smiles=C(=CC1(=CC=C(O)C=C1))CO}}
+
−
{{#set: inchi key=InChIKey=PTNLHDGQWUGONS-OWOJBTEDSA-N}}
+
−
{{#set: common name=4-coumaryl alcohol}}
+
−
{{#set: molecular weight=150.177   }}
+
−
{{#set: common name=p-coumaryl alcohol}}
+
−
{{#set: produced by=RXN-1102}}
+

Latest revision as of 20:03, 21 March 2018

Gene Ec-07_005240

  • left end position:
    • 5097069
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5108542
  • centisome position:
    • 66.00343
  • Synonym(s):
    • Esi_0176_0045
    • Esi0176_0045

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_005240&oldid=24164"