Difference between revisions of "RXN-5285"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(N)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5285 RXN-5285] == * direction: ** LEFT-TO-RIGHT * common name: ** Protochlorophyllide reductase...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CTP CTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5285 RXN-5285] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(N)=NC(=O)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PCDQPRRSZKQHHS-XVFCMESISA-J
+
 
* common name:
 
* common name:
−
** CTP
+
** Protochlorophyllide reductase, putative chloroplast precursor
−
* molecular weight:
+
* ec number:
−
** 479.127   
+
** [http://enzyme.expasy.org/EC/1.3.1.33 EC-1.3.1.33]
 
* Synonym(s):
 
* Synonym(s):
−
** cytidine-triphosphate
 
−
** cytidine-5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.7.7.15-RXN]]
+
* With identifiers:
−
* [[2.7.7.14-RXN]]
+
** 1 [[PROTON]][c] '''+''' 1 [[DIVINYL-PROTOCHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[DIVINYLCHLOROPHYLLIDE-A]][c] '''+''' 1 [[NADP]][c]
−
* [[RXN0-7080]]
+
* With common name(s):
−
* [[RXN-12200]]
+
** 1 H+[c] '''+''' 1 3,8-divinyl protochlorophyllide a[c] '''+''' 1 NADPH[c] '''=>''' 1 3,8-divinyl chlorophyllide a[c] '''+''' 1 NADP+[c]
−
* [[RXN0-5515]]
+
 
−
* [[RXN0-723]]
+
== Genes associated with this reaction  ==
−
* [[RXN-12959]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[2.7.7.60-RXN]]
+
* Gene: [[Ec-20_003900]]
−
* [[RXN-12195]]
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[DOLICHOL-KINASE-RXN]]
+
*** Assignment: EC-NUMBER
−
* [[CDPDIGLYSYN-RXN]]
+
== Pathways  ==
−
== Reaction(s) known to produce the compound ==
+
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
−
* [[RXN-14325]]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
−
* [[CTPSYN-RXN]]
+
== Reconstruction information  ==
−
* [[CDPKIN-RXN]]
+
* Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 65-47-4
+
* LIGAND-RXN:
−
* BIGG : 33710
+
** [http://www.genome.jp/dbget-bin/www_bget?R06286 R06286]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058166 7058166]
+
{{#set: common name=Protochlorophyllide reductase, putative chloroplast precursor}}
−
* HMDB : HMDB00082
+
{{#set: ec number=EC-1.3.1.33}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-20_003900}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00063 C00063]
+
{{#set: in pathway=CHLOROPHYLL-SYN}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.5414498.html 5414498]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=37563 37563]
+
−
* METABOLIGHTS : MTBLC37563
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(N)=NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=PCDQPRRSZKQHHS-XVFCMESISA-J}}
+
−
{{#set: common name=CTP}}
+
−
{{#set: molecular weight=479.127    }}
+
−
{{#set: common name=cytidine-triphosphate|cytidine-5'-triphosphate}}
+
−
{{#set: consumed by=2.7.7.15-RXN|2.7.7.14-RXN|RXN0-7080|RXN-12200|RXN0-5515|RXN0-723|RXN-12959|2.7.7.60-RXN|RXN-12195|DOLICHOL-KINASE-RXN|CDPDIGLYSYN-RXN}}
+
−
{{#set: produced by=RXN-14325|CTPSYN-RXN|CDPKIN-RXN}}
+

Latest revision as of 19:03, 21 March 2018

Reaction RXN-5285

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Protochlorophyllide reductase, putative chloroplast precursor
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • CHLOROPHYLL-SYN, 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): CHLOROPHYLL-SYN
    • 6 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-5285&oldid=24213"