Difference between revisions of "Ec-21 004220"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * inchi key: ** InChIKey=IJQSOC...")
(Created page with "Category:Gene == Gene Ec-21_004220 == * left end position: ** 5164100 * transcription direction: ** POSITIVE * right end position: ** 5181227 * centisome position: ** 69.9...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] ==
+
== Gene Ec-21_004220 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C(O)C(O)C(O)CCl
+
** 5164100
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5-chloro-5-deoxy-D-ribonate
+
** 5181227
−
* molecular weight:
+
* centisome position:
−
** 183.568    
+
** 69.97313    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0311_0012
 +
** Esi0311_0012
 +
** LHCP35
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11717]]
+
* Reaction: [[PHOSGLYPHOS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[PWY-7003]]
 +
* [[GLUCONEO-PWY]]
 +
* [[SUCSYN-PWY]]
 +
* [[PWY-6901]]
 +
* [[P124-PWY]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-6886]]
 +
* [[CALVIN-PWY]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 +
* [[P185-PWY]]
 +
* [[P122-PWY]]
 +
* [[PWY66-399]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5164100}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}}
+
{{#set: right end position=5181227}}
−
{{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}}
+
{{#set: centisome position=69.97313    }}
−
{{#set: common name=5-chloro-5-deoxy-D-ribonate}}
+
{{#set: common name=Esi_0311_0012|Esi0311_0012|LHCP35}}
−
{{#set: molecular weight=183.568    }}
+
{{#set: reaction associated=PHOSGLYPHOS-RXN}}
−
{{#set: consumed by=RXN-11717}}
+
{{#set: pathway associated=PWY-1042|PWY-7003|GLUCONEO-PWY|SUCSYN-PWY|PWY-6901|P124-PWY|GLYCOLYSIS|PWY-6886|CALVIN-PWY|ANAGLYCOLYSIS-PWY|PWY-5484|P185-PWY|P122-PWY|PWY66-399}}

Latest revision as of 20:03, 21 March 2018

Gene Ec-21_004220

  • left end position:
    • 5164100
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5181227
  • centisome position:
    • 69.97313
  • Synonym(s):
    • Esi_0311_0012
    • Esi0311_0012
    • LHCP35

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-21_004220&oldid=24232"