Difference between revisions of "CPD-4573"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...")
 
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674]
+
** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
 +
* inchi key:
 +
** InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
 
* common name:
 
* common name:
−
** L-tryptophan degradation XI (mammalian, via kynurenine)
+
** 14-oxolanosterol
 +
* molecular weight:
 +
** 440.708   
 
* Synonym(s):
 
* Synonym(s):
 +
** 14-oxo-lanosterol
 +
** 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''8''' reactions found over '''17''' reactions in the full pathway
+
* [[RXN66-305]]
−
* [[2.6.1.7-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** 1 associated gene(s):
+
* [[RXN66-304]]
−
*** [[Ec-00_001230]]
+
== Reaction(s) of unknown directionality ==
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
+
−
** 3 associated gene(s):
+
−
*** [[Ec-26_002430]]
+
−
*** [[Ec-26_001830]]
+
−
*** [[Ec-28_001680]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[PWY-5651]]
+
−
** 0 associated gene:
+
−
* [[PWY-5652]]
+
−
** 0 associated gene:
+
−
* [[RXN-10720]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-10721]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-00_001230]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-10722]]
+
−
** 0 associated gene:
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
* [[RXN-8665]]
+
−
** 1 associated gene(s):
+
−
*** [[Ec-20_001720]]
+
−
** 1 reconstruction source(s) associated:
+
−
*** [[annotation-esiliculosus_genome]]
+
−
== Reaction(s) not found ==
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=1.13.11.6-RXN 1.13.11.6-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-KYNURENINASE-RXN 3-HYDROXY-KYNURENINASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=ARYLFORMAMIDASE-RXN ARYLFORMAMIDASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=KYNURENINASE-RXN KYNURENINASE-RXN]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6504 PWY-6504]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=PWY-6504 PWY-6504]
+
−
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10723 RXN-10723]
+
 
== External links  ==
 
== External links  ==
−
{{#set: taxonomic range=TAX-40674}}
+
* PUBCHEM:
−
{{#set: common name=L-tryptophan degradation XI (mammalian, via kynurenine)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203567 25203567]
−
{{#set: reaction found=8}}
+
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
−
{{#set: total reaction=17}}
+
{{#set: inchi key=InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N}}
−
{{#set: completion rate=47.0}}
+
{{#set: common name=14-oxolanosterol}}
 +
{{#set: molecular weight=440.708    }}
 +
{{#set: common name=14-oxo-lanosterol|4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol}}
 +
{{#set: consumed by=RXN66-305}}
 +
{{#set: produced by=RXN66-304}}

Latest revision as of 19:04, 21 March 2018

Metabolite CPD-4573

  • smiles:
    • CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
  • inchi key:
    • InChIKey=PGGIMLIQOHYFIS-PUXRVUTHSA-N
  • common name:
    • 14-oxolanosterol
  • molecular weight:
    • 440.708
  • Synonym(s):
    • 14-oxo-lanosterol
    • 4,4-dimethyl-14α-formyl-5α-cholesta-8,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-4573&oldid=24293"