Difference between revisions of "8-AMINO-7-OXONONANOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C(CCCCCC([O-])=O)=O)[N+] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** 8-amino-7-oxononanoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 187.238 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7-keto-8-aminopelargonate |
− | + | ** KAPA | |
− | ** | + | ** 7-KAP |
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[7KAPSYN-RXN]] | ||
+ | * [[RXN-11484]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[DAPASYN-RXN]] |
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01092 C01092] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532] |
− | * | + | * BIGG : 36792 |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: inchi key=InChIKey= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029] |
− | {{#set: common name= | + | * HMDB : HMDB37790 |
− | {{#set: molecular weight= | + | {{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N}} |
− | {{#set: | + | {{#set: common name=8-amino-7-oxononanoate}} |
− | {{#set: reversible reaction associated= | + | {{#set: molecular weight=187.238 }} |
+ | {{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}} | ||
+ | {{#set: produced by=7KAPSYN-RXN|RXN-11484}} | ||
+ | {{#set: reversible reaction associated=DAPASYN-RXN}} |
Latest revision as of 19:04, 21 March 2018
Contents
Metabolite 8-AMINO-7-OXONONANOATE
- smiles:
- CC(C(CCCCCC([O-])=O)=O)[N+]
- inchi key:
- InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
- common name:
- 8-amino-7-oxononanoate
- molecular weight:
- 187.238
- Synonym(s):
- 7-keto-8-aminopelargonate
- KAPA
- 7-KAP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(CCCCCC([O-])=O)=O)[N+" cannot be used as a page name in this wiki.