Difference between revisions of "PWY-5994"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C(CCCCCC([O-])=O)=O)[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154]
−
* inchi key:
+
−
** InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 8-amino-7-oxononanoate
+
** palmitate biosynthesis I (animals and fungi)
−
* molecular weight:
+
−
** 187.238   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7-keto-8-aminopelargonate
+
** palmitic acid biosynthesis
−
** KAPA
+
** de novo lipogenesis
−
** 7-KAP
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''20''' reactions found over '''31''' reactions in the full pathway
−
* [[7KAPSYN-RXN]]
+
* [[4.2.1.58-RXN]]
−
* [[RXN-11484]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[DAPASYN-RXN]]
+
*** [[annotation-esiliculosus_genome]]
 +
* [[4.2.1.61-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9514]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9515]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9518]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9524]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9528]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9532]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9533]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9536]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9537]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9540]]
 +
** 1 associated gene(s):
 +
*** [[Ec-01_007100]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9549]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-9648]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9650]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-27_003480]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9651]]
 +
** 4 associated gene(s):
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-27_003480]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9652]]
 +
** 4 associated gene(s):
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9653]]
 +
** 4 associated gene(s):
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
*** [[Ec-12_000650]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9654]]
 +
** 4 associated gene(s):
 +
*** [[Ec-12_000650]]
 +
*** [[Ec-27_003480]]
 +
*** [[Ec-27_002090]]
 +
*** [[Ec-12_000640]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-9655]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.21-RXN 3.1.2.21-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.59-RXN 4.2.1.59-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PALMITOYL-COA-HYDROLASE-RXN PALMITOYL-COA-HYDROLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9520 RXN-9520]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9521 RXN-9521]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9530 RXN-9530]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9534 RXN-9534]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9542 RXN-9542]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-9780 RXN3O-9780]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-33154}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01092 C01092]
+
{{#set: common name=palmitate biosynthesis I (animals and fungi)}}
−
* CHEBI:
+
{{#set: common name=palmitic acid biosynthesis|de novo lipogenesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532]
+
{{#set: reaction found=20}}
−
* BIGG : 36792
+
{{#set: total reaction=31}}
−
* PUBCHEM:
+
{{#set: completion rate=65.0}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029]
+
−
* HMDB : HMDB37790
+
−
{{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}}
+
−
{{#set: inchi key=InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N}}
+
−
{{#set: common name=8-amino-7-oxononanoate}}
+
−
{{#set: molecular weight=187.238    }}
+
−
{{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}}
+
−
{{#set: produced by=7KAPSYN-RXN|RXN-11484}}
+
−
{{#set: reversible reaction associated=DAPASYN-RXN}}
+

Latest revision as of 19:04, 21 March 2018

Pathway PWY-5994

  • taxonomic range:
  • common name:
    • palmitate biosynthesis I (animals and fungi)
  • Synonym(s):
    • palmitic acid biosynthesis
    • de novo lipogenesis

Reaction(s) found

20 reactions found over 31 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5994&oldid=24360"