Difference between revisions of "RXN0-745"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-745 RXN0-745] == * direction: ** LEFT-TO-RIGHT * common name: ** ribonucleoside-triphosphate r...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-745 RXN0-745] ==
* smiles:
+
* direction:
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J
+
 
* common name:
 
* common name:
** isobutanoyl-CoA
+
** ribonucleoside-triphosphate reductase
* molecular weight:
+
* ec number:
** 833.593   
+
** [http://enzyme.expasy.org/EC/1.17.4.2 EC-1.17.4.2]
 
* Synonym(s):
 
* Synonym(s):
** 2-methylpropanoyl-CoA
 
** isobutyryl-coenzyme A
 
** 2-methylpropionyl-CoA
 
** S-(2-methylpropanoyl)-CoA
 
** isobutyryl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[MEPROPCOA-FAD-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[ATP]][c] '''+''' 1 [[Reduced-flavodoxins]][c] '''=>''' 1 [[Oxidized-flavodoxins]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[DATP]][c]
* [[1.2.1.25-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 ATP[c] '''+''' 1 a reduced flavodoxin[c] '''=>''' 1 an oxidized flavodoxin[c] '''+''' 1 H2O[c] '''+''' 1 dATP[c]
* [[2.3.1.168-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_006460]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-7220]], adenosine deoxyribonucleotides de novo biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7220 PWY-7220]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 15621-60-0
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=ribonucleoside-triphosphate reductase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266570 45266570]
+
{{#set: ec number=EC-1.17.4.2}}
* HMDB : HMDB01243
+
{{#set: gene associated=Ec-04_006460}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-7220}}
** [http://www.genome.jp/dbget-bin/www_bget?C00630 C00630]
+
{{#set: reconstruction category=annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57338 57338]
+
{{#set: reconstruction tool=pathwaytools}}
* METABOLIGHTS : MTBLC57338
+
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C}}
+
{{#set: inchi key=InChIKey=AEWHYWSPVRZHCT-NDZSKPAWSA-J}}
+
{{#set: common name=isobutanoyl-CoA}}
+
{{#set: molecular weight=833.593    }}
+
{{#set: common name=2-methylpropanoyl-CoA|isobutyryl-coenzyme A|2-methylpropionyl-CoA|S-(2-methylpropanoyl)-CoA|isobutyryl-CoA}}
+
{{#set: consumed by=MEPROPCOA-FAD-RXN}}
+
{{#set: produced by=1.2.1.25-RXN}}
+
{{#set: reversible reaction associated=2.3.1.168-RXN}}
+

Latest revision as of 19:05, 21 March 2018

Reaction RXN0-745

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ribonucleoside-triphosphate reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7220, adenosine deoxyribonucleotides de novo biosynthesis II: PWY-7220
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links