Difference between revisions of "CPD-7087"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYRIBONUCSYN-RXN GLYRIBONUCSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphoribo...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYRIBONUCSYN-RXN GLYRIBONUCSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)
 +
* inchi key:
 +
** InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M
 
* common name:
 
* common name:
** phosphoribosylamine-glycine ligase
+
** (+)-dihydromyricetin
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/6.3.4.13 EC-6.3.4.13]
+
** 319.247   
 
* Synonym(s):
 
* Synonym(s):
 +
** (+)-ampelopsin
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-8450]]
** 1 [[ATP]][c] '''+''' 1 [[GLY]][c] '''+''' 1 [[5-P-BETA-D-RIBOSYL-AMINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[5-PHOSPHO-RIBOSYL-GLYCINEAMIDE]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c]
+
* [[RXN-7784]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1 ATP[c] '''+''' 1 glycine[c] '''+''' 1 5-phospho-β-D-ribosylamine[c] '''=>''' 1 H+[c] '''+''' 1 N1-(5-phospho-β-D-ribosyl)glycinamide[c] '''+''' 1 ADP[c] '''+''' 1 phosphate[c]
+
* [[RXN-7922]]
 
+
== Reaction(s) of unknown directionality ==
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Ec-12_005490]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Assignment: GO-TERM
+
** Source: [[orthology-aragem]]
+
== Pathways  ==
+
* [[PWY-6121]], 5-aminoimidazole ribonucleotide biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6121 PWY-6121]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-6122]], 5-aminoimidazole ribonucleotide biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122]
+
** '''3''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-6277]], superpathway of 5-aminoimidazole ribonucleotide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6277 PWY-6277]
+
** '''5''' reactions found over '''9''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-aragem]]
+
*** Tool: [[pantograph]]
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17453 17453]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244375 25244375]
* LIGAND-RXN:
+
* CHEBI:
** [http://www.genome.jp/dbget-bin/www_bget?R04144 R04144]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28429 28429]
* UNIPROT:
+
* METABOLIGHTS : MTBLC28429
** [http://www.uniprot.org/uniprot/P07244 P07244]
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/Q58347 Q58347]
+
** [http://www.genome.jp/dbget-bin/www_bget?C02906 C02906]
** [http://www.uniprot.org/uniprot/P12039 P12039]
+
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)}}
** [http://www.uniprot.org/uniprot/P21872 P21872]
+
{{#set: inchi key=InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M}}
** [http://www.uniprot.org/uniprot/P15640 P15640]
+
{{#set: common name=(+)-dihydromyricetin}}
** [http://www.uniprot.org/uniprot/P00967 P00967]
+
{{#set: molecular weight=319.247    }}
** [http://www.uniprot.org/uniprot/P16340 P16340]
+
{{#set: common name=(+)-ampelopsin}}
** [http://www.uniprot.org/uniprot/P22102 P22102]
+
{{#set: consumed by=RXN-8450|RXN-7784}}
** [http://www.uniprot.org/uniprot/Q9JWU6 Q9JWU6]
+
{{#set: produced by=RXN-7922}}
** [http://www.uniprot.org/uniprot/P43845 P43845]
+
** [http://www.uniprot.org/uniprot/Q9PN47 Q9PN47]
+
** [http://www.uniprot.org/uniprot/Q64737 Q64737]
+
** [http://www.uniprot.org/uniprot/P20772 P20772]
+
** [http://www.uniprot.org/uniprot/P26977 P26977]
+
** [http://www.uniprot.org/uniprot/Q59492 Q59492]
+
** [http://www.uniprot.org/uniprot/P74232 P74232]
+
** [http://www.uniprot.org/uniprot/Q42804 Q42804]
+
** [http://www.uniprot.org/uniprot/P52421 P52421]
+
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=phosphoribosylamine-glycine ligase}}
+
{{#set: ec number=EC-6.3.4.13}}
+
{{#set: gene associated=Ec-12_005490}}
+
{{#set: in pathway=PWY-6121|PWY-6122|PWY-6277}}
+
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:05, 21 March 2018

Metabolite CPD-7087

  • smiles:
    • C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)
  • inchi key:
    • InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M
  • common name:
    • (+)-dihydromyricetin
  • molecular weight:
    • 319.247
  • Synonym(s):
    • (+)-ampelopsin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)" cannot be used as a page name in this wiki.