Difference between revisions of "CPD-8058"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-28_003620 == * left end position: ** 3442609 * transcription direction: ** NEGATIVE * right end position: ** 3451321 * centisome position: ** 90.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * smiles: ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) * inchi key...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == |
| − | * | + | * smiles: |
| − | ** | + | ** COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N |
| − | * | + | * common name: |
| − | ** | + | ** D-galactosylononitol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 356.326 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** galactosyl sequoyitol |
| − | ** | + | ** O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-8281]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202605 25202605] |
| − | {{#set: | + | {{#set: smiles=COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=D-galactosylononitol}} |
| − | {{#set: | + | {{#set: molecular weight=356.326 }} |
| + | {{#set: common name=galactosyl sequoyitol|O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol}} | ||
| + | {{#set: produced by=RXN-8281}} | ||
Latest revision as of 20:06, 21 March 2018
Contents
Metabolite CPD-8058
- smiles:
- COC1(C(C(C(C(C1O)O)O)O)OC2(C(C(C(C(O2)CO)O)O)O))
- inchi key:
- InChIKey=RSYNCMYDVZFZBP-NRORZAABSA-N
- common name:
- D-galactosylononitol
- molecular weight:
- 356.326
- Synonym(s):
- galactosyl sequoyitol
- O-α-D-galactopyranosyl-(1,3)-4O-methyl-D-myo-inositol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
