Difference between revisions of "ASN-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN-tRNAs ASN-tRNAs] == * common name: ** tRNAasn * Synonym(s): ** TRNA(ASN) == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ASN-tRNAs ASN-tRNAs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** tRNAasn |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** TRNA(ASN) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ASPARAGINE--TRNA-LIGASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12460]] | |
| − | * [[RXN- | + | |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=tRNAasn}} | |
| − | + | {{#set: common name=TRNA(ASN)}} | |
| − | + | {{#set: consumed by=ASPARAGINE--TRNA-LIGASE-RXN}} | |
| − | + | {{#set: produced by=RXN-12460}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite ASN-tRNAs
- common name:
- tRNAasn
- Synonym(s):
- TRNA(ASN)
