Difference between revisions of "PWY-5321"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == * smiles: ** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1) * inchi key: ** I...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5321 PWY-5321] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-37...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5321 PWY-5321] ==
−
* smiles:
+
* taxonomic range:
−
** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-3700]
−
* inchi key:
+
−
** InChIKey=FPIPGXGPPPQFEQ-OVSJKPMPSA-N
+
 
* common name:
 
* common name:
−
** all-trans-retinol
+
** quercetin glycoside biosynthesis (Arabidopsis)
−
* molecular weight:
+
−
** 286.456   
+
 
* Synonym(s):
 
* Synonym(s):
−
** trans-retinol
 
−
** retinol
 
−
** vitamin A
 
−
** vitamin A1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''12''' reactions in the full pathway
−
* [[RXN-12575]]
+
* [[RXN1F-462]]
−
* [[3.1.1.64-RXN]]
+
** 2 associated gene(s):
−
* [[RXN-12579]]
+
*** [[Ec-14_000870]]
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-04_004610]]
−
* [[RETINOL-DEHYDROGENASE-RXN]]
+
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13797 RXN-13797]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14000 RXN-14000]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14011 RXN-14011]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14012 RXN-14012]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8264 RXN-8264]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8265 RXN-8265]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8267 RXN-8267]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8268 RXN-8268]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8271 RXN-8271]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4161 RXNQT-4161]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXNQT-4162 RXNQT-4162]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB00162
+
* ARACYC:
−
* CAS : 68-26-8
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5321 PWY-5321]
−
* CAS : 11103-57-4
+
{{#set: taxonomic range=TAX-3700}}
−
* Wikipedia : Retinol
+
{{#set: common name=quercetin glycoside biosynthesis (Arabidopsis)}}
−
* LIPID_MAPS : LMPR01090001
+
{{#set: reaction found=1}}
−
* PUBCHEM:
+
{{#set: total reaction=12}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445354 445354]
+
{{#set: completion rate=8.0}}
−
* HMDB : HMDB00305
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00473 C00473]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.393012.html 393012]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17336 17336]
+
−
* METABOLIGHTS : MTBLC17336
+
−
{{#set: smiles=CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1)}}
+
−
{{#set: inchi key=InChIKey=FPIPGXGPPPQFEQ-OVSJKPMPSA-N}}
+
−
{{#set: common name=all-trans-retinol}}
+
−
{{#set: molecular weight=286.456    }}
+
−
{{#set: common name=trans-retinol|retinol|vitamin A|vitamin A1}}
+
−
{{#set: produced by=RXN-12575|3.1.1.64-RXN|RXN-12579}}
+
−
{{#set: reversible reaction associated=RETINOL-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-5321

  • taxonomic range:
  • common name:
    • quercetin glycoside biosynthesis (Arabidopsis)
  • Synonym(s):

Reaction(s) found

1 reactions found over 12 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5321&oldid=24610"