Difference between revisions of "CPD-18550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11210 RXN-11210] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11210 RXN-11210] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.1.6 EC-3.5.1.6]
+
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
 +
* common name:
 +
** quinoxaline-2-carboxyl adenylate
 +
* molecular weight:
 +
** 502.359   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-17155]]
−
** 2 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[3-UREIDO-ISOBUTYRATE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-471]][c] '''+''' 1 [[AMMONIUM]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 H+[c] '''+''' 1 H2O[c] '''+''' 1 (R)-3-ureido-isobutanoate[c] '''=>''' 1 CO2[c] '''+''' 1 (R)-3-amino-2-methylpropanoate[c] '''+''' 1 ammonium[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Ec-16_003010]]
+
−
** Source: [[orthology-aragem]]
+
−
== Pathways  ==
+
−
* [[PWY-6430]], thymine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6430 PWY-6430]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-aragem]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
−
{{#set: ec number=EC-3.5.1.6}}
+
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
−
{{#set: gene associated=Ec-16_003010}}
+
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
−
{{#set: in pathway=PWY-6430}}
+
{{#set: molecular weight=502.359    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-17155}}
−
{{#set: reconstruction source=orthology-aragem}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Latest revision as of 19:08, 21 March 2018

Metabolite CPD-18550

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
  • inchi key:
    • InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
  • common name:
    • quinoxaline-2-carboxyl adenylate
  • molecular weight:
    • 502.359
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-18550&oldid=24816"