Difference between revisions of "Ec-14 002580"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH...")
(Created page with "Category:Gene == Gene Ec-14_002580 == * left end position: ** 2449732 * transcription direction: ** POSITIVE * right end position: ** 2458006 * centisome position: ** 37.3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] ==
+
== Gene Ec-14_002580 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** 2449732
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (22α)-hydroxy-campest-4-en-3-one
+
** 2458006
−
* molecular weight:
+
* centisome position:
−
** 414.67    
+
** 37.34104    
 
* Synonym(s):
 
* Synonym(s):
−
** (22S)-22-hydroxy-campest-4-en-3-one
+
** Esi_0038_0142
−
** (22S,24R)-22-hydroxy-ergost-4-en-3-one
+
** Esi0038_0142
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[6.3.2.25-RXN]]
−
* [[RXN-4231]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMST01031116
+
{{#set: left end position=2449732}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201842 25201842]
+
{{#set: right end position=2458006}}
−
* CHEBI:
+
{{#set: centisome position=37.34104   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72330 72330]
+
{{#set: common name=Esi_0038_0142|Esi0038_0142}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=6.3.2.25-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15796 C15796]
+
−
* HMDB : HMDB12113
+
−
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N}}
+
−
{{#set: common name=(22α)-hydroxy-campest-4-en-3-one}}
+
−
{{#set: molecular weight=414.67   }}
+
−
{{#set: common name=(22S)-22-hydroxy-campest-4-en-3-one|(22S,24R)-22-hydroxy-ergost-4-en-3-one}}
+
−
{{#set: produced by=RXN-4231}}
+

Latest revision as of 19:08, 21 March 2018

Gene Ec-14_002580

  • left end position:
    • 2449732
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2458006
  • centisome position:
    • 37.34104
  • Synonym(s):
    • Esi_0038_0142
    • Esi0038_0142

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_002580&oldid=24837"