Difference between revisions of "CPD-17858"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-21_003680 == * left end position: ** 4649951 * transcription direction: ** POSITIVE * right end position: ** 4664761 * centisome position: ** 63.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-21_003680 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
−
* left end position:
+
* smiles:
−
** 4649951
+
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
−
* right end position:
+
* common name:
−
** 4664761
+
** ω-saturated C55 dolichol phosphate
−
* centisome position:
+
* molecular weight:
−
** 63.006447    
+
** 849.311    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0072_0101
+
** ω-saturated dolichol-11 phosphate
−
** Esi0072_0101
+
−
** PK
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[PROTEIN-KINASE-RXN]]
+
* [[RXN-16602]]
−
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) known to produce the compound ==
−
*** Assignment: go-term
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4649951}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
−
{{#set: right end position=4664761}}
+
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
−
{{#set: centisome position=63.006447   }}
+
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
−
{{#set: common name=Esi_0072_0101|Esi0072_0101|PK}}
+
{{#set: common name=ω-saturated C55 dolichol phosphate}}
−
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
{{#set: molecular weight=849.311   }}
 +
{{#set: common name=ω-saturated dolichol-11 phosphate}}
 +
{{#set: consumed by=RXN-16602}}

Latest revision as of 20:08, 21 March 2018

Metabolite CPD-17858

  • smiles:
    • CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
  • inchi key:
    • InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
  • common name:
    • ω-saturated C55 dolichol phosphate
  • molecular weight:
    • 849.311
  • Synonym(s):
    • ω-saturated dolichol-11 phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-17858&oldid=24840"