Difference between revisions of "PWY-3101"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
−
* inchi key:
+
−
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
+
 
* common name:
 
* common name:
−
** ω-saturated C55 dolichol phosphate
+
** flavonol biosynthesis
−
* molecular weight:
+
−
** 849.311   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ω-saturated dolichol-11 phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-16602]]
+
'''3''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-527]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Ec-08_003510]]
 +
*** [[Ec-19_002760]]
 +
*** [[Ec-19_002750]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN-8450]]
 +
** 3 associated gene(s):
 +
*** [[Ec-19_002760]]
 +
*** [[Ec-08_003510]]
 +
*** [[Ec-19_002750]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN1F-93]]
 +
** 3 associated gene(s):
 +
*** [[Ec-19_002760]]
 +
*** [[Ec-08_003510]]
 +
*** [[Ec-19_002750]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12510 RXN-12510]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13718 RXN-13718]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-525 RXN-525]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7782 RXN-7782]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3101 PWY-3101]
−
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
+
{{#set: taxonomic range=TAX-58024}}
−
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
+
{{#set: common name=flavonol biosynthesis}}
−
{{#set: common name=ω-saturated C55 dolichol phosphate}}
+
{{#set: reaction found=3}}
−
{{#set: molecular weight=849.311    }}
+
{{#set: total reaction=7}}
−
{{#set: common name=ω-saturated dolichol-11 phosphate}}
+
{{#set: completion rate=43.0}}
−
{{#set: consumed by=RXN-16602}}
+

Latest revision as of 19:09, 21 March 2018

Pathway PWY-3101

  • taxonomic range:
  • common name:
    • flavonol biosynthesis
  • Synonym(s):

Reaction(s) found

3 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-3101&oldid=24877"