Difference between revisions of "RXN-8999"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8999 RXN-8999] == * direction: ** LEFT-TO-RIGHT * common name: ** Di-trans-poly-cis-decaprenylc...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8999 RXN-8999] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 5-monophosphate
+
** Di-trans-poly-cis-decaprenylcistransferase
−
* molecular weight:
+
* ec number:
−
** 258.121   
+
** [http://enzyme.expasy.org/EC/2.5.1.31 EC-2.5.1.31]
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 5-monophosphate
 
−
** Ins(5)P1
 
−
** 1D-myo-inositol 5-phosphate
 
−
** Ins(5)P
 
−
** Ins5P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10953]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[FARNESYL-PP]][c] '''+''' 8 [[DELTA3-ISOPENTENYL-PP]][c] '''=>''' 1 [[UNDECAPRENYL-DIPHOSPHATE]][c] '''+''' 8 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (2E,6E)-farnesyl diphosphate[c] '''+''' 8 isopentenyl diphosphate[c] '''=>''' 1 di-trans,octa-cis-undecaprenyl diphosphate[c] '''+''' 8 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-05_002690]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-5785]], di-trans,poly-cis-undecaprenyl phosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5785 PWY-5785]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
* RHEA:
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27551 27551]
−
{{#set: common name=1D-myo-inositol 5-monophosphate}}
+
* LIGAND-RXN:
−
{{#set: molecular weight=258.121    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06447 R06447]
−
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R07269 R07269]
−
{{#set: consumed by=RXN-10953}}
+
* UNIPROT:
 +
** [http://www.uniprot.org/uniprot/O82827 O82827]
 +
** [http://www.uniprot.org/uniprot/O43091 O43091]
 +
** [http://www.uniprot.org/uniprot/Q9JX35 Q9JX35]
 +
** [http://www.uniprot.org/uniprot/O67291 O67291]
 +
** [http://www.uniprot.org/uniprot/Q9X1B8 Q9X1B8]
 +
** [http://www.uniprot.org/uniprot/O34559 O34559]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=Di-trans-poly-cis-decaprenylcistransferase}}
 +
{{#set: ec number=EC-2.5.1.31}}
 +
{{#set: gene associated=Ec-05_002690}}
 +
{{#set: in pathway=PWY-5785}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:09, 21 March 2018

Reaction RXN-8999

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Di-trans-poly-cis-decaprenylcistransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5785, di-trans,poly-cis-undecaprenyl phosphate biosynthesis: PWY-5785
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-8999&oldid=24952"