Difference between revisions of "RXN66-305"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] == * direction: ** LEFT-TO-RIGHT * common name: ** 14-oxolanosterol deformylas...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-305 RXN66-305] ==
−
* smiles:
+
* direction:
−
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
+
 
* common name:
 
* common name:
−
** cis-coumarinic acid-β-D-glucoside
+
** 14-oxolanosterol deformylase
−
* molecular weight:
+
** Cytochrome P450
−
** 325.294   
+
 
* Synonym(s):
 
* Synonym(s):
−
** coumarinic acid glucoside
 
−
** coumarinate glucoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8036]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-4573]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[44-DIMETHYL-CHOLESTA-812-24-TRIENOL]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[FORMATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 14-oxolanosterol[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''=>''' 1 4,4-dimethyl-cholesta-8,12,24-trienol[c] '''+''' 1 H2O[c] '''+''' 1 NADP+[c] '''+''' 1 formate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_006240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
+
{{#set: common name=14-oxolanosterol deformylase}}
−
* CHEBI:
+
{{#set: common name=Cytochrome P450}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
+
{{#set: gene associated=Ec-10_006240}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY66-341|PWY66-4}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
+
{{#set: reconstruction category=annotation}}
−
* HMDB : HMDB60077
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
+
−
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
+
−
{{#set: molecular weight=325.294    }}
+
−
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
+
−
{{#set: consumed by=RXN-8036}}
+

Latest revision as of 20:11, 21 March 2018

Reaction RXN66-305

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 14-oxolanosterol deformylase
    • Cytochrome P450
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-341, cholesterol biosynthesis I: PWY66-341
    • 9 reactions found over 22 reactions in the full pathway
  • PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
    • 9 reactions found over 22 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-305&oldid=25108"