Difference between revisions of "PWY-6873"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NARINGENIN-CMPD NARINGENIN-CMPD] == * smiles: ** C3(=C(C2(OC1(C(=C(C=C(C=1)O)O)C(C2)=O)))C=CC(=...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6873 PWY-6873] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NARINGENIN-CMPD NARINGENIN-CMPD] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6873 PWY-6873] ==
* smiles:
+
* taxonomic range:
** C3(=C(C2(OC1(C(=C(C=C(C=1)O)O)C(C2)=O)))C=CC(=C3)O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=FTVWIRXFELQLPI-ZDUSSCGKSA-N
+
 
* common name:
 
* common name:
** (2S)-naringenin
+
** long chain fatty acid ester synthesis (engineered)
* molecular weight:
+
** 272.257   
+
 
* Synonym(s):
 
* Synonym(s):
** (2S)-4',5,7-trihydroxyflavanone
 
** (2S)-5,7,4'-trihydroxyflavone
 
** (2S)-4',5,7-trihydroxyflavan-4-one
 
** (S)-naringenin
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-7904]]
* [[APIGNAR-RXN]]
+
** 4 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-02_006430]]
 +
*** [[Ec-12_008720]]
 +
*** [[Ec-03_003710]]
 +
*** [[Ec-01_001560]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11039 RXN-11039]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12639 RXN-12639]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6161 RXN-6161]
 
== External links  ==
 
== External links  ==
* CAS : 480-41-1
+
{{#set: taxonomic range=TAX-2}}
* DRUGBANK : DB03467
+
{{#set: common name=long chain fatty acid ester synthesis (engineered)}}
* PUBCHEM:
+
{{#set: reaction found=1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439246 439246]
+
{{#set: total reaction=4}}
* HMDB : HMDB02670
+
{{#set: completion rate=25.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00509 C00509]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17846 17846]
+
* METABOLIGHTS : MTBLC17846
+
{{#set: smiles=C3(=C(C2(OC1(C(=C(C=C(C=1)O)O)C(C2)=O)))C=CC(=C3)O)}}
+
{{#set: inchi key=InChIKey=FTVWIRXFELQLPI-ZDUSSCGKSA-N}}
+
{{#set: common name=(2S)-naringenin}}
+
{{#set: molecular weight=272.257    }}
+
{{#set: common name=(2S)-4',5,7-trihydroxyflavanone|(2S)-5,7,4'-trihydroxyflavone|(2S)-4',5,7-trihydroxyflavan-4-one|(S)-naringenin}}
+
{{#set: consumed by=NARINGENIN-3-DIOXYGENASE-RXN}}
+
{{#set: produced by=APIGNAR-RXN}}
+

Latest revision as of 19:12, 21 March 2018

Pathway PWY-6873

  • taxonomic range:
  • common name:
    • long chain fatty acid ester synthesis (engineered)
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links