Difference between revisions of "PWY-6348"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18493 CPD-18493] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6348 PWY-6348] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18493 CPD-18493] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6348 PWY-6348] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=NNEPPYNERZEJEE-VUGYPBMHSA-J
+
 
* common name:
 
* common name:
** (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
+
** phosphate acquisition
* molecular weight:
+
** 1120.05   
+
 
* Synonym(s):
 
* Synonym(s):
** (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17115]]
+
'''1''' reactions found over '''1''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ACID-PHOSPHATASE-RXN]]
* [[RXN-17114]]
+
** 13 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Ec-26_006410]]
 +
*** [[Ec-21_003560]]
 +
*** [[Ec-19_000870]]
 +
*** [[Ec-20_003560]]
 +
*** [[Ec-27_003870]]
 +
*** [[Ec-05_000260]]
 +
*** [[Ec-05_004740]]
 +
*** [[Ec-19_002110]]
 +
*** [[Ec-21_005990]]
 +
*** [[Ec-20_002470]]
 +
*** [[Ec-07_000930]]
 +
*** [[Ec-24_000520]]
 +
*** [[Ec-00_000940]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: taxonomic range=TAX-2759}}
{{#set: inchi key=InChIKey=NNEPPYNERZEJEE-VUGYPBMHSA-J}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=(3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}}
+
{{#set: common name=phosphate acquisition}}
{{#set: molecular weight=1120.05    }}
+
{{#set: reaction found=1}}
{{#set: common name=(3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}}
+
{{#set: total reaction=1}}
{{#set: consumed by=RXN-17115}}
+
{{#set: completion rate=100.0}}
{{#set: produced by=RXN-17114}}
+

Latest revision as of 19:12, 21 March 2018

Pathway PWY-6348

  • taxonomic range:
  • common name:
    • phosphate acquisition
  • Synonym(s):

Reaction(s) found

1 reactions found over 1 reactions in the full pathway

Reaction(s) not found

External links