Difference between revisions of "PWY-6370"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * inchi key: ** In...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6370 PWY-6370] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ascorbate recycling (cytosolic) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** ( | + | ** vitamin C recycling (cytosolic) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''6''' reactions in the full pathway |
− | * [[ | + | * [[1.6.5.4-RXN]] |
− | * [[RXN- | + | ** 2 associated gene(s): |
− | + | *** [[Ec-26_002470]] | |
− | * [[RXN- | + | *** [[Ec-22_003850]] |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
− | * [ | + | *** [[annotation-esiliculosus_genome]] |
+ | *** [[orthology-aragem]] | ||
+ | * [[1.8.5.1-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-02_003740]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-10981]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[RXN-3523]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10980 RXN-10980] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3522 RXN-3522] | ||
== External links == | == External links == | ||
− | + | * LIGAND-MAP: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00053 map00053] | |
− | + | {{#set: taxonomic range=TAX-7742}} | |
− | + | {{#set: common name=ascorbate recycling (cytosolic)}} | |
− | + | {{#set: common name=vitamin C recycling (cytosolic)}} | |
− | * LIGAND- | + | {{#set: reaction found=4}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: total reaction=6}} |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name=( | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:12, 21 March 2018
Pathway PWY-6370
- taxonomic range:
- common name:
- ascorbate recycling (cytosolic)
- Synonym(s):
- vitamin C recycling (cytosolic)
Reaction(s) found
4 reactions found over 6 reactions in the full pathway
- 1.6.5.4-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- 1.8.5.1-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-10981
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-3523
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP: