Difference between revisions of "Ec-26 002470"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GLUTAMATE-5-P L-GLUTAMATE-5-P] == * smiles: ** C(CCC(C(=O)[O-])[N+])(OP([O-])(=O)[O-])=O * in...") |
(Created page with "Category:Gene == Gene Ec-26_002470 == * left end position: ** 2776518 * transcription direction: ** POSITIVE * right end position: ** 2782971 * centisome position: ** 42.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-26_002470 == |
− | * | + | * left end position: |
− | ** | + | ** 2776518 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2782971 |
− | * | + | * centisome position: |
− | ** | + | ** 42.174866 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0212_0027 |
− | ** | + | ** Esi0212_0027 |
+ | ** MDAR-like | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[1.6.5.4-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | ** Source: [[orthology-aragem]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6370]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2776518}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2782971}} | |
− | + | {{#set: centisome position=42.174866 }} | |
− | + | {{#set: common name=Esi_0212_0027|Esi0212_0027|MDAR-like}} | |
− | + | {{#set: reaction associated=1.6.5.4-RXN}} | |
− | + | {{#set: pathway associated=PWY-6370}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:13, 21 March 2018
Gene Ec-26_002470
- left end position:
- 2776518
- transcription direction:
- POSITIVE
- right end position:
- 2782971
- centisome position:
- 42.174866
- Synonym(s):
- Esi_0212_0027
- Esi0212_0027
- MDAR-like
Reactions associated
- Reaction: 1.6.5.4-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome