Difference between revisions of "RXN-2001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2001 RXN-2001] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15153 CPD-15153] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-2001 RXN-2001] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N
+
** [http://enzyme.expasy.org/EC/6.2.1 EC-6.2.1]
−
* common name:
+
−
** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+
−
* molecular weight:
+
−
** 697.095   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14177]]
+
** 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-674]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[CINNAMOYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ATP[c] '''+''' 1 coenzyme A[c] '''+''' 1 trans-cinnamate[c] '''=>''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 (E)-cinnamoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-04_001280]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-10_001480]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-6457]], trans-cinnamoyl-CoA biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6457 PWY-6457]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* LIGAND-RXN:
−
** [http://www.genome.jp/dbget-bin/www_bget?C05814 C05814]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02255 R02255]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28636 28636]
+
{{#set: ec number=EC-6.2.1}}
−
* PUBCHEM:
+
{{#set: gene associated=Ec-04_001280|Ec-10_001480}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280836 5280836]
+
{{#set: in pathway=PWY-6457}}
−
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C(C)=1)}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=FLYBTLROCQBHMR-KFSSTAEESA-N}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: common name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=697.095    }}
+
−
{{#set: produced by=RXN-14177}}
+

Latest revision as of 19:13, 21 March 2018

Reaction RXN-2001

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ATP[c] + 1 coenzyme A[c] + 1 trans-cinnamate[c] => 1 AMP[c] + 1 diphosphate[c] + 1 (E)-cinnamoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6457, trans-cinnamoyl-CoA biosynthesis: PWY-6457
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-2001&oldid=25394"