Difference between revisions of "Ec-06 010220"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...")
(Created page with "Category:Gene == Gene Ec-06_010220 == * left end position: ** 7994025 * transcription direction: ** NEGATIVE * right end position: ** 8000514 * centisome position: ** 91.2...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
+
== Gene Ec-06_010220 ==
−
* smiles:
+
* left end position:
−
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
+
** 7994025
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 6,7-dehydrobaicalein
+
** 8000514
−
* molecular weight:
+
* centisome position:
−
** 268.225    
+
** 91.27936    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0136_0068
 +
** Esi0136_0068
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
* [[RXN-14240]]
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ATPSYN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7994025}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
+
{{#set: right end position=8000514}}
−
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
+
{{#set: centisome position=91.27936    }}
−
{{#set: common name=6,7-dehydrobaicalein}}
+
{{#set: common name=Esi_0136_0068|Esi0136_0068}}
−
{{#set: molecular weight=268.225    }}
+
{{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}}
−
{{#set: produced by=RXN-14240}}
+
{{#set: pathway associated=PWY-7219}}

Latest revision as of 20:13, 21 March 2018

Gene Ec-06_010220

  • left end position:
    • 7994025
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 8000514
  • centisome position:
    • 91.27936
  • Synonym(s):
    • Esi_0136_0068
    • Esi0136_0068

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_010220&oldid=25448"