Difference between revisions of "3.1.27.9-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.9-RXN 3.1.27.9-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** tRNA-splicing endonuc...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.27.9-RXN 3.1.27.9-RXN] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
+
 
* common name:
 
* common name:
−
** (2E,7Z)-hexadecenoyl-CoA
+
** tRNA-splicing endonuclease subunit Sen15
−
* molecular weight:
+
* ec number:
−
** 997.883   
+
** [http://enzyme.expasy.org/EC/4.6.1.16 EC-4.6.1.16]
 
* Synonym(s):
 
* Synonym(s):
−
** 16:2-Δ2,Δ7-CoA
 
−
** 2-trans,7-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17780]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD0-2350]][c] '''=>''' 1 [[tRNA-Introns]][c] '''+''' 1 [[Pre-tRNA-3-prime-half-molecules]][c] '''+''' 1 [[Pre-tRNA-5-prime-half-molecules]][c]
−
* [[RXN-17779]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a polycistronic tRNA precursor[c] '''=>''' 1 a tRNA intron with a 2',3'-cyclic phosphate and a 5'-hydroxyl terminus[c] '''+''' 1 a 3' half-tRNA molecule with a hydroxyl on its 5' end[c] '''+''' 1 a 5' half-tRNA molecule with a 2',3' cyclic phosphate on its 3' end[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_006500]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6689]], tRNA splicing: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6689 PWY-6689]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* UNIPROT:
−
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
+
** [http://www.uniprot.org/uniprot/O07118 O07118]
−
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=997.883    }}
+
{{#set: common name=tRNA-splicing endonuclease subunit Sen15}}
−
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
+
{{#set: ec number=EC-4.6.1.16}}
−
{{#set: consumed by=RXN-17780}}
+
{{#set: gene associated=Ec-21_006500}}
−
{{#set: produced by=RXN-17779}}
+
{{#set: in pathway=PWY-6689}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:14, 21 March 2018

Reaction 3.1.27.9-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • tRNA-splicing endonuclease subunit Sen15
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6689, tRNA splicing: PWY-6689
    • 5 reactions found over 5 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3.1.27.9-RXN&oldid=25501"