Difference between revisions of "PWY-6837"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCDP DCDP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(=O)([O-])[O-])([O-])=O * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''2''' reactions found over '''5''' reactions in the full pathway |
− | * [[ | + | * [[RXN-12518]] |
− | + | ** 3 associated gene(s): | |
− | * [[ | + | *** [[Ec-22_002920]] |
− | * [[RXN- | + | *** [[Ec-08_006390]] |
− | * [[ | + | *** [[Ec-26_004320]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | == Reaction(s) | + | *** [[annotation-esiliculosus_genome]] |
+ | * [[RXN-12521]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Ec-16_003950]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12519 RXN-12519] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12520 RXN-12520] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7836 RXN-7836] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33154}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=40.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:16, 21 March 2018
Pathway PWY-6837
- taxonomic range:
- common name:
- fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent)
- Synonym(s):
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- RXN-12518
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-12521
- 1 associated gene(s):
- 1 reconstruction source(s) associated: