Difference between revisions of "Charged-THR-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-THR-tRNAs Charged-THR-tRNAs] == * common name: ** an L-threonyl-[tRNAthr] * Synonym(s):...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7006 CPD-7006] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-THR-tRNAs Charged-THR-tRNAs] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
* inchi key:
+
** InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M
+
 
* common name:
 
* common name:
** tetrahydrogeranylgeranyl chlorophyll a
+
** an L-threonyl-[tRNAthr]
* molecular weight:
+
** 890.479   
+
 
* Synonym(s):
 
* Synonym(s):
** tetrahydroGG-chlorophyll a
 
** tetrahydroGG-chl a
 
** tetrahydrogeranylgeranyl-chl a
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7666]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7665]]
+
* [[THREONINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an L-threonyl-[tRNAthr]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926313 46926313]
+
{{#set: produced by=THREONINE--TRNA-LIGASE-RXN}}
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: inchi key=InChIKey=NVDIDZKEPDPXJJ-ONWAGYJKSA-M}}
+
{{#set: common name=tetrahydrogeranylgeranyl chlorophyll a}}
+
{{#set: molecular weight=890.479    }}
+
{{#set: common name=tetrahydroGG-chlorophyll a|tetrahydroGG-chl a|tetrahydrogeranylgeranyl-chl a}}
+
{{#set: consumed by=RXN-7666}}
+
{{#set: produced by=RXN-7665}}
+

Latest revision as of 19:17, 21 March 2018

Metabolite Charged-THR-tRNAs

  • common name:
    • an L-threonyl-[tRNAthr]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-threonyl-[tRNAthr" cannot be used as a page name in this wiki.