Difference between revisions of "ADENOSYLCOBINAMIDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-Fatty-Acyl-CoA Saturated-Fatty-Acyl-CoA] == * common name: ** a 2,3,4-saturated fatty...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE ADENOSYLCOBINAMIDE] == * smiles: ** C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENOSYLCOBINAMIDE ADENOSYLCOBINAMIDE] == |
| + | * smiles: | ||
| + | ** C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O | ||
| + | * inchi key: | ||
| + | ** InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** adenosylcobinamide |
| + | * molecular weight: | ||
| + | ** 1240.332 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** AdoCbi | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[BTUR2-RXN]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06508 C06508] |
| − | {{#set: produced by= | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=2480 2480] | ||
| + | * BIGG : 48459 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819767 91819767] | ||
| + | * HMDB : HMDB06903 | ||
| + | {{#set: smiles=C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O}} | ||
| + | {{#set: inchi key=InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M}} | ||
| + | {{#set: common name=adenosylcobinamide}} | ||
| + | {{#set: molecular weight=1240.332 }} | ||
| + | {{#set: common name=AdoCbi}} | ||
| + | {{#set: produced by=BTUR2-RXN}} | ||
Latest revision as of 19:18, 21 March 2018
Contents
Metabolite ADENOSYLCOBINAMIDE
- smiles:
- C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O
- inchi key:
- InChIKey=KQXSPGAEBZWHMC-VUCSARQQSA-M
- common name:
- adenosylcobinamide
- molecular weight:
- 1240.332
- Synonym(s):
- AdoCbi
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[CH](CNC(CCC4(C8(N3([Co--]17([N+]5(C(=C(C)C2(=[N+]1C(C(C2CCC(N)=O)(CC(=O)N)C)(C)[CH]3C(CC(=O)N)4))C(C(CCC(=O)N)C=5C=C6(C(C)(C)C(CCC(=O)N)C(=[N+]67)C=8C))(CC(=O)N)C))CC9(OC(C(O)C(O)9)N%11(C=NC%10(=C(N)N=CN=C%10%11))))))C)=O)O" cannot be used as a page name in this wiki.
