Difference between revisions of "RXN-6601"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8259 CPD-8259] == * smiles: ** C(O)C1(C(O)C(O)C(O1)[N+]2(C=CC=C(C(=O)[O-])C=2)) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] == * direction: ** LEFT-TO-RIGHT * common name: ** Gamma-glutamyltranspeptidase...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-6601 RXN-6601] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Gamma-glutamyltranspeptidase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.2.2 EC-2.3.2.2] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[GLUTATHIONE]][c] '''+''' 1 [[Amino-Acids-20]][c] '''=>''' 1 [[5-L-GLUTAMYL-L-AMINO-ACID]][c] '''+''' 1 [[CYS-GLY]][c] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 glutathione[c] '''+''' 1 a standard α amino acid[c] '''=>''' 1 an (γ-L-glutamyl)-L-amino acid[c] '''+''' 1 L-cysteinyl-glycine[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-21_006220]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041] | ||
| + | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=Gamma-glutamyltranspeptidase}} | |
| − | + | {{#set: ec number=EC-2.3.2.2}} | |
| − | + | {{#set: gene associated=Ec-21_006220}} | |
| − | + | {{#set: in pathway=PWY-4041}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:19, 21 March 2018
Contents
Reaction RXN-6601
- direction:
- LEFT-TO-RIGHT
- common name:
- Gamma-glutamyltranspeptidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GLUTATHIONE[c] + 1 Amino-Acids-20[c] => 1 5-L-GLUTAMYL-L-AMINO-ACID[c] + 1 CYS-GLY[c]
- With common name(s):
- 1 glutathione[c] + 1 a standard α amino acid[c] => 1 an (γ-L-glutamyl)-L-amino acid[c] + 1 L-cysteinyl-glycine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-21_006220
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
