Difference between revisions of "D-GALACTONO-1-4-LACTONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLUCOSE-16-BISPHOSPHATE ALPHA-GLUCOSE-16-BISPHOSPHATE] == * smiles: ** C(OP([O-])(=O)[O-]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GALACTONO-1-4-LACTONE D-GALACTONO-1-4-LACTONE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N |
* common name: | * common name: | ||
− | ** | + | ** D-galactono-1,4-lactone |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 178.141 |
* Synonym(s): | * Synonym(s): | ||
− | ** & | + | ** D-galactonate-γ-lactone |
− | ** & | + | ** galactono-γ-lactone |
+ | ** D-galactonolactone | ||
+ | ** D-galactono-γ-lactone | ||
+ | ** D-galactonic acid γ-lactone | ||
+ | ** γ-D-galactonolactone | ||
+ | ** D-(-)-galactonic acid γ-lactone | ||
+ | ** D-galactonic acid g-lactone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[GALACTONOLACTONASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 2782-07-2 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=97165 97165] |
− | * | + | * HMDB : HMDB02541 |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03383 C03383] |
− | * | + | * CHEMSPIDER: |
− | {{#set: smiles=C( | + | ** [http://www.chemspider.com/Chemical-Structure.92162.html 92162] |
− | {{#set: inchi key=InChIKey= | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15895 15895] |
− | {{#set: molecular weight= | + | {{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}} |
− | {{#set: common name=& | + | {{#set: inchi key=InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N}} |
− | {{#set: | + | {{#set: common name=D-galactono-1,4-lactone}} |
+ | {{#set: molecular weight=178.141 }} | ||
+ | {{#set: common name=D-galactonate-γ-lactone|galactono-γ-lactone|D-galactonolactone|D-galactono-γ-lactone|D-galactonic acid γ-lactone|γ-D-galactonolactone|D-(-)-galactonic acid γ-lactone|D-galactonic acid g-lactone}} | ||
+ | {{#set: consumed by=GALACTONOLACTONASE-RXN}} |
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite D-GALACTONO-1-4-LACTONE
- smiles:
- C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
- inchi key:
- InChIKey=SXZYCXMUPBBULW-AIHAYLRMSA-N
- common name:
- D-galactono-1,4-lactone
- molecular weight:
- 178.141
- Synonym(s):
- D-galactonate-γ-lactone
- galactono-γ-lactone
- D-galactonolactone
- D-galactono-γ-lactone
- D-galactonic acid γ-lactone
- γ-D-galactonolactone
- D-(-)-galactonic acid γ-lactone
- D-galactonic acid g-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.