Difference between revisions of "RXN1G-526"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYXYLULOSE-5P DEOXYXYLULOSE-5P] == * smiles: ** CC(=O)C(O)C(O)COP([O-])(=O)[O-] * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-526 RXN1G-526] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-tetracos-2-enoyl-[acy...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-526 RXN1G-526] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-tetracos-2-enoyl-[acyl-carrier protein] reductase |
| − | * | + | ** Glucose/ribitol dehydrogenase |
| − | ** | + | * ec number: |
| + | ** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[trans-delta2-lignoceroyl-ACPs]][c] '''=>''' 1 [[Lignoceroyl-ACPs]][c] '''+''' 1 [[NAD]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a trans-tetracos-2-enoyl-[acp][c] '''=>''' 1 a lignoceroyl-[acp][c] '''+''' 1 NAD+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-27_002470]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321] | ||
| + | ** '''30''' reactions found over '''182''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=trans-tetracos-2-enoyl-[acyl-carrier protein] reductase}} | |
| − | + | {{#set: common name=Glucose/ribitol dehydrogenase}} | |
| − | + | {{#set: ec number=EC-1.3.1.9}} | |
| − | + | {{#set: gene associated=Ec-27_002470}} | |
| − | + | {{#set: in pathway=PWYG-321}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:21, 21 March 2018
Contents
Reaction RXN1G-526
- direction:
- LEFT-TO-RIGHT
- common name:
- trans-tetracos-2-enoyl-[acyl-carrier protein] reductase
- Glucose/ribitol dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADH[c] + 1 PROTON[c] + 1 trans-delta2-lignoceroyl-ACPs[c] => 1 Lignoceroyl-ACPs[c] + 1 NAD[c]
- With common name(s):
- 1 NADH[c] + 1 H+[c] + 1 a trans-tetracos-2-enoyl-[acp][c] => 1 a lignoceroyl-[acp][c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-27_002470
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
"trans-tetracos-2-enoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.
