Difference between revisions of "PWY-5109"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] == * smiles: ** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O) * inchi key: ** In...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5109 PWY-5109] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5109 PWY-5109] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-methylbutanoate biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** 2 | + | ** 2-methylbutyrate biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''4''' reactions found over '''6''' reactions in the full pathway |
− | + | * [[1.1.1.178-RXN]] | |
− | * [[ | + | ** 0 associated gene: |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
− | == Reaction(s) | + | *** [[annotation-esiliculosus_genome]] |
+ | * [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | * [[METHYLACETOACETYLCOATHIOL-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Ec-26_003940]] | ||
+ | *** [[Ec-22_002850]] | ||
+ | *** [[Ec-24_000870]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | * [[TIGLYLCOA-HYDROXY-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Ec-16_003560]] | ||
+ | *** [[Ec-16_001250]] | ||
+ | *** [[Ec-06_001380]] | ||
+ | *** [[Ec-14_006530]] | ||
+ | *** [[Ec-17_000320]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=PROPIONATE-COA-TRANSFERASE-RXN PROPIONATE-COA-TRANSFERASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15031 RXN-15031] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33208}} | |
− | + | {{#set: common name=2-methylbutanoate biosynthesis}} | |
− | + | {{#set: common name=2-methylbutyrate biosynthesis}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:21, 21 March 2018
Pathway PWY-5109
- taxonomic range:
- common name:
- 2-methylbutanoate biosynthesis
- Synonym(s):
- 2-methylbutyrate biosynthesis
Reaction(s) found
4 reactions found over 6 reactions in the full pathway
- 1.1.1.178-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- 2-METHYLACYL-COA-DEHYDROGENASE-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- METHYLACETOACETYLCOATHIOL-RXN
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
- TIGLYLCOA-HYDROXY-RXN
- 5 associated gene(s):
- 2 reconstruction source(s) associated: