Difference between revisions of "CPD-11408"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_008050 == * left end position: ** 7129680 * transcription direction: ** POSITIVE * right end position: ** 7137809 * centisome position: ** 85.5...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] == * smiles: ** C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11408 CPD-11408] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=XBQYQXVJBNDCGY-LBPRGKRZSA-M |
| − | * | + | * common name: |
| − | ** | + | ** triiodothyronine sulfate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 730.028 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** triiodothyronine sulfuric ester |
| − | ** | + | ** 3,3',5-triiodo-L-thyronine sulfate |
| − | ** | + | ** 3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine |
| + | ** L-tyrosine, 3,5-diiodo-O-(3-iodo-4-(sulfooxy)phenyl)- | ||
| + | ** (2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-10615]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657986 90657986] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35432 35432] |
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC35432 |
| − | + | * HMDB : HMDB03036 | |
| − | {{#set: | + | {{#set: smiles=C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I)}} |
| + | {{#set: inchi key=InChIKey=XBQYQXVJBNDCGY-LBPRGKRZSA-M}} | ||
| + | {{#set: common name=triiodothyronine sulfate}} | ||
| + | {{#set: molecular weight=730.028 }} | ||
| + | {{#set: common name=triiodothyronine sulfuric ester|3,3',5-triiodo-L-thyronine sulfate|3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine|L-tyrosine, 3,5-diiodo-O-(3-iodo-4-(sulfooxy)phenyl)-|(2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid}} | ||
| + | {{#set: produced by=RXN-10615}} | ||
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite CPD-11408
- smiles:
- C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I)
- inchi key:
- InChIKey=XBQYQXVJBNDCGY-LBPRGKRZSA-M
- common name:
- triiodothyronine sulfate
- molecular weight:
- 730.028
- Synonym(s):
- triiodothyronine sulfuric ester
- 3,3',5-triiodo-L-thyronine sulfate
- 3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine
- L-tyrosine, 3,5-diiodo-O-(3-iodo-4-(sulfooxy)phenyl)-
- (2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C=C(OS(=O)(=O)[O-])C(=CC(OC1(C(=CC(=CC(I)=1)CC(C(=O)[O-])[N+])I))=2)I)" cannot be used as a page name in this wiki.
- "3,5-diiodo-O-[3-iodo-4-(sulfooxy)phenyl]-L-tyrosine" cannot be used as a page name in this wiki.
- "(2S)-2-amino-3-{3,5-diiodo-4-[3-iodo-4-(sulfooxy)phenoxy]phenyl}propanoic acid" cannot be used as a page name in this wiki.
