Difference between revisions of "PWY-7172"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3041 CPD-3041] == * smiles: ** C2(C=C(O)C=CC(C=CC(=O)C1(C(=CC(O)=CC=1)O))=2) * inchi key: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7172 PWY-7172] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7172 PWY-7172] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''7''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[RXN1F-462]] |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| − | == | + | *** [[Ec-14_000870]] |
| + | *** [[Ec-04_004610]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13983 RXN-13983] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13984 RXN-13984] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13985 RXN-13985] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13986 RXN-13986] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13987 RXN-13987] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13988 RXN-13988] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-58024}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=7}} | |
| − | + | {{#set: completion rate=14.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 19:22, 21 March 2018
Pathway PWY-7172
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 7 reactions in the full pathway
- RXN1F-462
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
