Difference between revisions of "RXN-11356"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11356 RXN-11356] == * direction: ** LEFT-TO-RIGHT * common name: ** zeta-carotene desaturase, c...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11356 RXN-11356] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C(OP(=O)([O-])[O-])CO
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K
+
 
* common name:
 
* common name:
−
** 2-phospho-D-glycerate
+
** zeta-carotene desaturase, chloroplast precursor
−
* molecular weight:
+
−
** 183.034   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-phospho-(D)-glycerate
+
** ζ-carotene desaturase
−
** 2-phospho-(R)-glycerate
+
** ZDS
−
** 2-phospho-D-glyceric acid
+
−
** 2-P-D-glycerate
+
−
** D-Glycerate 2-phosphate
+
−
** D-2-phosphoglycerate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PHOSPHOGLYCERATE-PHOSPHATASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-7526]][c] '''+''' 1 [[ETR-Quinones]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[CPD-7524]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[3PGAREARR-RXN]]
+
** 1 9,9'-di-cis-ζ-carotene[c] '''+''' 1 an electron-transfer quinone[c] '''=>''' 1 an electron-transfer quinol[c] '''+''' 1 7,9,9'-cis-neurosporene[c]
−
* [[2PGADEHYDRAT-RXN]]
+
 
−
* [[RXN-15513]]
+
== Genes associated with this reaction  ==
−
* [[RXN-15510]]
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_004660]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6475]], trans-lycopene biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475]
 +
** '''4''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 2553-59-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 35542
+
{{#set: common name=zeta-carotene desaturase, chloroplast precursor}}
−
* PUBCHEM:
+
{{#set: common name=ζ-carotene desaturase|ZDS}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467846 40467846]
+
{{#set: gene associated=Ec-02_004660}}
−
* HMDB : HMDB03391
+
{{#set: in pathway=PWY-6475}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00631 C00631]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58289 58289]
+
−
* METABOLIGHTS : MTBLC58289
+
−
{{#set: smiles=C(=O)([O-])C(OP(=O)([O-])[O-])CO}}
+
−
{{#set: inchi key=InChIKey=GXIURPTVHJPJLF-UWTATZPHSA-K}}
+
−
{{#set: common name=2-phospho-D-glycerate}}
+
−
{{#set: molecular weight=183.034    }}
+
−
{{#set: common name=2-phospho-(D)-glycerate|2-phospho-(R)-glycerate|2-phospho-D-glyceric acid|2-P-D-glycerate|D-Glycerate 2-phosphate|D-2-phosphoglycerate}}
+
−
{{#set: consumed by=PHOSPHOGLYCERATE-PHOSPHATASE-RXN}}
+
−
{{#set: reversible reaction associated=3PGAREARR-RXN|2PGADEHYDRAT-RXN|RXN-15513|RXN-15510}}
+

Latest revision as of 19:23, 21 March 2018

Reaction RXN-11356

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • zeta-carotene desaturase, chloroplast precursor
  • Synonym(s):
    • ζ-carotene desaturase
    • ZDS

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 9,9'-di-cis-ζ-carotene[c] + 1 an electron-transfer quinone[c] => 1 an electron-transfer quinol[c] + 1 7,9,9'-cis-neurosporene[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6475, trans-lycopene biosynthesis II (plants): PWY-6475
    • 4 reactions found over 8 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-11356&oldid=26501"