Difference between revisions of "RXN66-313"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * smiles: ** C(=O)([O-])CC(=N)C(=O)[O-] * inchi key: ** InChI...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-313 RXN66-313] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-beta hydroxysteroid dehyd...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-313 RXN66-313] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])CC(=N)C(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 2-iminosuccinate
+
** 3-beta hydroxysteroid dehydrogenase/isomerase
−
* molecular weight:
+
* ec number:
−
** 129.072   
+
** [http://enzyme.expasy.org/EC/1.1.1.170 EC-1.1.1.170]
 
* Synonym(s):
 
* Synonym(s):
−
** 2-iminobutanedioate
 
−
** α-iminosuccinate
 
−
** iminoaspartate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[QUINOLINATE-SYNTHA-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-4577]][c] '''+''' 1 [[NAD-P-OR-NOP]][c] '''=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[CPD-4578]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[L-ASPARTATE-OXID-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 4α-carboxy-4β-methyl-5α-cholesta-8,24-dien-3β-ol[c] '''+''' 1 NAD(P)+[c] '''=>''' 1 NAD(P)H[c] '''+''' 1 3-dehydro-4-methylzymosterol[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-21_001850]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-341]], cholesterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-341 PWY66-341]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
* [[PWY-6074]], zymosterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6074 PWY-6074]
 +
** '''4''' reactions found over '''12''' reactions in the full pathway
 +
* [[PWY66-4]], cholesterol biosynthesis III (via desmosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-4 PWY66-4]
 +
** '''9''' reactions found over '''22''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615393 23615393]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33448 33448]
−
* HMDB : HMDB01131
+
* LIGAND-RXN:
−
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07494 R07494]
−
** [http://www.genome.jp/dbget-bin/www_bget?C05840 C05840]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* CHEMSPIDER:
+
{{#set: common name=3-beta hydroxysteroid dehydrogenase/isomerase}}
−
** [http://www.chemspider.com/Chemical-Structure.19951415.html 19951415]
+
{{#set: ec number=EC-1.1.1.170}}
−
* CHEBI:
+
{{#set: gene associated=Ec-21_001850}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58831 58831]
+
{{#set: in pathway=PWY66-341|PWY-6074|PWY66-4}}
−
* BIGG : 46611
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(=O)([O-])CC(=N)C(=O)[O-]}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=NMUOATVLLQEYHI-UHFFFAOYSA-L}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=2-iminosuccinate}}
+
−
{{#set: molecular weight=129.072    }}
+
−
{{#set: common name=2-iminobutanedioate|α-iminosuccinate|iminoaspartate}}
+
−
{{#set: consumed by=QUINOLINATE-SYNTHA-RXN}}
+
−
{{#set: produced by=L-ASPARTATE-OXID-RXN}}
+

Latest revision as of 19:23, 21 March 2018

Reaction RXN66-313

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-beta hydroxysteroid dehydrogenase/isomerase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-341, cholesterol biosynthesis I: PWY66-341
    • 9 reactions found over 22 reactions in the full pathway
  • PWY-6074, zymosterol biosynthesis: PWY-6074
    • 4 reactions found over 12 reactions in the full pathway
  • PWY66-4, cholesterol biosynthesis III (via desmosterol): PWY66-4
    • 9 reactions found over 22 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN66-313&oldid=26544"