Difference between revisions of "Ec-24 003900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * inchi key: ** InChIKey=WHUUTDBJXJR...")
(Created page with "Category:Gene == Gene Ec-24_003900 == * left end position: ** 4279411 * transcription direction: ** POSITIVE * right end position: ** 4282712 * centisome position: ** 85.7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] ==
+
== Gene Ec-24_003900 ==
−
* smiles:
+
* left end position:
−
** C(CCC(C(=O)[O-])[N+])([O-])=O
+
** 4279411
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** D-glutamate
+
** 4282712
−
* molecular weight:
+
* centisome position:
−
** 146.122    
+
** 85.79977    
 
* Synonym(s):
 
* Synonym(s):
−
** D-glutamic acid
+
** Esi_0109_0086
−
** D-glu
+
** Esi0109_0086
 +
** ACP
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-17155]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7735]]
 
== External links  ==
 
== External links  ==
−
* CAS : 6893-26-1
+
{{#set: left end position=4279411}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297]
+
{{#set: right end position=4282712}}
−
* HMDB : HMDB03339
+
{{#set: centisome position=85.79977   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0109_0086|Esi0109_0086|ACP}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217]
+
{{#set: reaction associated=RXN-17155}}
−
* CHEBI:
+
{{#set: pathway associated=PWY-7735}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986]
+
−
* BIGG : 34285
+
−
{{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}}
+
−
{{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}}
+
−
{{#set: common name=D-glutamate}}
+
−
{{#set: molecular weight=146.122   }}
+
−
{{#set: common name=D-glutamic acid|D-glu}}
+
−
{{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE-RXN}}
+

Latest revision as of 20:23, 21 March 2018

Gene Ec-24_003900

  • left end position:
    • 4279411
  • transcription direction:
    • POSITIVE
  • right end position:
    • 4282712
  • centisome position:
    • 85.79977
  • Synonym(s):
    • Esi_0109_0086
    • Esi0109_0086
    • ACP

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-24_003900&oldid=26566"