Difference between revisions of "Ec-02 001010"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-02_001010 == * Synonym(s): ** Esi_0040_0046 ** Esi0040_0046 == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-aragem...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_001010 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0040_0046 |
− | ** | + | ** Esi0040_0046 |
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | + | ** Source: [[orthology-aragem]] | |
− | * [[ | + | == Pathways associated == |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0040_0046|Esi0040_0046}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 19:23, 21 March 2018
Gene Ec-02_001010
- Synonym(s):
- Esi_0040_0046
- Esi0040_0046
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-aragem