Difference between revisions of "PWY-5408"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4143 CPD-4143] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5408 PWY-5408] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4143 CPD-4143] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5408 PWY-5408] ==
* smiles:
+
* taxonomic range:
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
* inchi key:
+
** InChIKey=KZJWDPNRJALLNS-VJSFXXLFSA-N
+
 
* common name:
 
* common name:
** sitosterol
+
** 9-lipoxygenase and 9-hydroperoxide lyase pathway
* molecular weight:
+
** 414.713   
+
 
* Synonym(s):
 
* Synonym(s):
** β-sitosterol
+
** 9-LOX and 9-HPL pathway
** quebrachol
+
** 9-oxo-nonanoate biosynthesis
** cinchol
+
** cupreol
+
** rhamnol
+
** 22,23-dihydrostigmasterol
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12789]]
+
'''1''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-8497]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Ec-03_000010]]
 +
*** [[Ec-20_003630]]
 +
*** [[Ec-20_003620]]
 +
*** [[Ec-03_000020]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8495 RXN-8495]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8502 RXN-8502]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8503 RXN-8503]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMST01040129
+
{{#set: taxonomic range=TAX-33090}}
* PUBCHEM:
+
{{#set: common name=9-lipoxygenase and 9-hydroperoxide lyase pathway}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=222284 222284]
+
{{#set: common name=9-LOX and 9-HPL pathway|9-oxo-nonanoate biosynthesis}}
* HMDB : HMDB00852
+
{{#set: reaction found=1}}
* LIGAND-CPD:
+
{{#set: total reaction=4}}
** [http://www.genome.jp/dbget-bin/www_bget?C01753 C01753]
+
{{#set: completion rate=25.0}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.192962.html 192962]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27693 27693]
+
* METABOLIGHTS : MTBLC27693
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=KZJWDPNRJALLNS-VJSFXXLFSA-N}}
+
{{#set: common name=sitosterol}}
+
{{#set: molecular weight=414.713    }}
+
{{#set: common name=β-sitosterol|quebrachol|cinchol|cupreol|rhamnol|22,23-dihydrostigmasterol}}
+
{{#set: consumed by=RXN-12789}}
+

Latest revision as of 19:24, 21 March 2018

Pathway PWY-5408

  • taxonomic range:
  • common name:
    • 9-lipoxygenase and 9-hydroperoxide lyase pathway
  • Synonym(s):
    • 9-LOX and 9-HPL pathway
    • 9-oxo-nonanoate biosynthesis

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links