Difference between revisions of "CPD-12017"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-08_001740 == * left end position: ** 1783064 * transcription direction: ** POSITIVE * right end position: ** 1794738 * centisome position: ** 26.6...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Ec-08_001740 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
* left end position:
+
* smiles:
** 1783064
+
** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
* right end position:
+
* common name:
** 1794738
+
** N-acetyl-serotonin sulfate
* centisome position:
+
* molecular weight:
** 26.624554    
+
** 297.305    
 
* Synonym(s):
 
* Synonym(s):
** Esi_0007_0074
+
** N-acetyl-5-hydroxytryptamine sulfate
** Esi0007_0074
+
** Gpx4
+
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[GLUTATHIONE-PEROXIDASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-esiliculosus_genome]]
+
* [[RXN-11059]]
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[DETOX1-PWY-1]]
+
* [[PWY-4081]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1783064}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479248 45479248]
{{#set: right end position=1794738}}
+
* HMDB : HMDB60834
{{#set: centisome position=26.624554   }}
+
{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
{{#set: common name=Esi_0007_0074|Esi0007_0074|Gpx4}}
+
{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
{{#set: reaction associated=GLUTATHIONE-PEROXIDASE-RXN}}
+
{{#set: common name=N-acetyl-serotonin sulfate}}
{{#set: pathway associated=DETOX1-PWY-1|PWY-4081}}
+
{{#set: molecular weight=297.305   }}
 +
{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
 +
{{#set: produced by=RXN-11059}}

Latest revision as of 20:25, 21 March 2018

Metabolite CPD-12017

  • smiles:
    • CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
  • inchi key:
    • InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
  • common name:
    • N-acetyl-serotonin sulfate
  • molecular weight:
    • 297.305
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.