Difference between revisions of "CPD-3943"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17115 RXN-17115] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17115 RXN-17115] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.1.1 EC-1.1.1]
+
** InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
 +
* common name:
 +
** (22α)-hydroxy-campesterol
 +
* molecular weight:
 +
** 416.686   
 
* Synonym(s):
 
* Synonym(s):
 +
** (22S)-22-hydroxy-campesterol
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[NAD]][c] '''+''' 1 [[CPD-18493]][c] '''=>''' 1 [[CPD-18494]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c]
+
* [[RXN-4225]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NAD+[c] '''+''' 1 (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] '''=>''' 1 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADH[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726]
+
** '''13''' reactions found over '''13''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-esiliculosus_genome]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIPID_MAPS : LMST01031115
{{#set: ec number=EC-1.1.1}}
+
* PUBCHEM:
{{#set: in pathway=PWY-7726}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11133505 11133505]
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.chemspider.com/Chemical-Structure.9308624.html 9308624]
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72331 72331]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C15795 C15795]
 +
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N}}
 +
{{#set: common name=(22α)-hydroxy-campesterol}}
 +
{{#set: molecular weight=416.686    }}
 +
{{#set: common name=(22S)-22-hydroxy-campesterol}}
 +
{{#set: produced by=RXN-4225}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-3943

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=LSZJAIFORSLKOY-PACUACIMSA-N
  • common name:
    • (22α)-hydroxy-campesterol
  • molecular weight:
    • 416.686
  • Synonym(s):
    • (22S)-22-hydroxy-campesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.