Difference between revisions of "Ec-05 006370"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Gene == Gene Ec-05_006370 == * left end position: ** 8385529 * transcription direction: ** POSITIVE * right end position: ** 8412690 * centisome position: ** 92.1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
+
== Gene Ec-05_006370 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 8385529
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** phytenoyl-CoA
+
** 8412690
−
* molecular weight:
+
* centisome position:
−
** 1056.006    
+
** 92.113205    
 
* Synonym(s):
 
* Synonym(s):
−
** E-phytenoyl-CoA
+
** Esi_0075_0055
−
** trans-phytenoyl-CoA
+
** Esi0075_0055
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-482]]
+
* Reaction: [[3.5.1.98-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN66-480]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=8385529}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: right end position=8412690}}
−
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
+
{{#set: centisome position=92.113205   }}
−
{{#set: common name=phytenoyl-CoA}}
+
{{#set: common name=Esi_0075_0055|Esi0075_0055}}
−
{{#set: molecular weight=1056.006   }}
+
{{#set: reaction associated=3.5.1.98-RXN}}
−
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
+
−
{{#set: consumed by=RXN66-482}}
+
−
{{#set: produced by=RXN66-480}}
+

Latest revision as of 19:26, 21 March 2018

Gene Ec-05_006370

  • left end position:
    • 8385529
  • transcription direction:
    • POSITIVE
  • right end position:
    • 8412690
  • centisome position:
    • 92.113205
  • Synonym(s):
    • Esi_0075_0055
    • Esi0075_0055

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-05_006370&oldid=26938"