Difference between revisions of "PWY-6109"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * smiles: ** C(C(C1(C=CC(=CC=1)O))OC2(OC(C(C(C2O)O)O)CO))#N * inchi key:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6109 PWY-6109] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40029 TAX-4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6109 PWY-6109] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40029 TAX-40029] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** mangrove triterpenoid biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** taraxerol biosynthesis |
− | ** | + | ** germanicol biosynthesis |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''6''' reactions in the full pathway |
− | == Reaction(s) | + | * [[CYCLOARTENOL-SYNTHASE-RXN]] |
− | == | + | ** 2 associated gene(s): |
+ | *** [[Ec-07_006170]] | ||
+ | *** [[Ec-00_010980]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | *** [[orthology-aragem]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-111 RXN-111] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7570 RXN-7570] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8434 RXN-8434] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9915 RXN-9915] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9916 RXN-9916] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-40029}} | |
− | + | {{#set: common name=mangrove triterpenoid biosynthesis}} | |
− | + | {{#set: common name=taraxerol biosynthesis|germanicol biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=17.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:26, 21 March 2018
Pathway PWY-6109
- taxonomic range:
- common name:
- mangrove triterpenoid biosynthesis
- Synonym(s):
- taraxerol biosynthesis
- germanicol biosynthesis
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- CYCLOARTENOL-SYNTHASE-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated: