Difference between revisions of "Ec-01 006680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] == * smiles: ** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C...")
(Created page with "Category:Gene == Gene Ec-01_006680 == * left end position: ** 5742730 * transcription direction: ** POSITIVE * right end position: ** 5752141 * centisome position: ** 55.6...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9039 CPD-9039] ==
+
== Gene Ec-01_006680 ==
−
* smiles:
+
* left end position:
−
** CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]
+
** 5742730
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E
+
** POSITIVE
−
* common name:
+
* right end position:
−
** cobalt-precorrin-2
+
** 5752141
−
* molecular weight:
+
* centisome position:
−
** 912.701    
+
** 55.652897    
 
* Synonym(s):
 
* Synonym(s):
−
** cobalt-dihydrosirohydrochlorin
+
** Esi_0002_0272
 +
** Esi0002_0272
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.1.151-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-8759]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-7434]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5742730}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820486 91820486]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5752141}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3790 3790]
+
{{#set: centisome position=55.652897   }}
−
{{#set: smiles=CC3(C4(=CC1(=[N+]6(C(C(C1CCC([O-])=O)(CC(=O)[O-])C)=CC2(N5(C(=C(C=2CC(=O)[O-])CCC(=O)[O-])CC8(N7(C(C=C(C(CCC(=O)[O-])3)N4[Co--]567)=C(C(CCC(=O)[O-])=8)CC([O-])=O))))))))CC(=O)[O-]}}
+
{{#set: common name=Esi_0002_0272|Esi0002_0272}}
−
{{#set: inchi key=InChIKey=LSYVTVRLOVEXCI-URAPKPMPSA-E}}
+
{{#set: reaction associated=2.4.1.151-RXN}}
−
{{#set: common name=cobalt-precorrin-2}}
+
{{#set: pathway associated=PWY-7434}}
−
{{#set: molecular weight=912.701   }}
+
−
{{#set: common name=cobalt-dihydrosirohydrochlorin}}
+
−
{{#set: reversible reaction associated=RXN-8759}}
+

Latest revision as of 19:27, 21 March 2018

Gene Ec-01_006680

  • left end position:
    • 5742730
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5752141
  • centisome position:
    • 55.652897
  • Synonym(s):
    • Esi_0002_0272
    • Esi0002_0272

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_006680&oldid=27027"