Difference between revisions of "BUTYRYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10720 RXN-10720] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] == * smiles: ** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA BUTYRYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J | ||
+ | * common name: | ||
+ | ** butanoyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 833.593 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** butyryl-CoA | ||
+ | ** butyryl-coenzyme A | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-12565]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * UM-BBD-CPD : c0023 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CAS : 2140-48-9 |
− | {{#set: | + | * BIGG : 33988 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244513 25244513] |
− | {{#set: | + | * HMDB : HMDB01088 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00136 C00136] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57371 57371] | ||
+ | * METABOLIGHTS : MTBLC57371 | ||
+ | {{#set: smiles=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J}} | ||
+ | {{#set: common name=butanoyl-CoA}} | ||
+ | {{#set: molecular weight=833.593 }} | ||
+ | {{#set: common name=butyryl-CoA|butyryl-coenzyme A}} | ||
+ | {{#set: consumed by=RXN-12565}} |
Latest revision as of 19:27, 21 March 2018
Contents
Metabolite BUTYRYL-COA
- smiles:
- CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=CRFNGMNYKDXRTN-HDRJHVAISA-J
- common name:
- butanoyl-CoA
- molecular weight:
- 833.593
- Synonym(s):
- butyryl-CoA
- butyryl-coenzyme A
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- UM-BBD-CPD : c0023
- CAS : 2140-48-9
- BIGG : 33988
- PUBCHEM:
- HMDB : HMDB01088
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57371
"CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.