Difference between revisions of "RXN-11881"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8121 CPD-8121] == * smiles: ** CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O * common name: ** icosatetr...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11881 RXN-11881] == * direction: ** LEFT-TO-RIGHT * common name: ** 4α,14α-dimethyl...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8121 CPD-8121] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11881 RXN-11881] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** icosatetraenoate
+
** 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase
−
* inchi key:
+
** Cytochrome P450
−
** InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/1.14.13.70 EC-1.14.13.70]
−
** 303.464   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (8Z,11Z,14Z,17Z)-eicosatetraenoic acid
 
−
** (8Z,11Z,14Z,17Z)-eicosatetraenoate
 
−
** (8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate
 
−
** ETA
 
−
** eicosatetraenoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-12852]][c] '''+''' 3 [[NADPH]][c] '''+''' 2 [[PROTON]][c] '''+''' 3 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[FORMATE]][c] '''+''' 1 [[CPD-12853]][c] '''+''' 4 [[WATER]][c] '''+''' 3 [[NADP]][c]
−
* [[RXN-8349_PLANTCYC]]
+
* With common name(s):
 +
** 1 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol[c] '''+''' 3 NADPH[c] '''+''' 2 H+[c] '''+''' 3 oxygen[c] '''=>''' 1 formate[c] '''+''' 1 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol[c] '''+''' 4 H2O[c] '''+''' 3 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-10_006240]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71563 71563]
+
{{#set: common name=4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase}}
−
* HMDB : HMDB02177
+
{{#set: common name=Cytochrome P450}}
−
* Wikipedia : Eicosatetraenoic_acid
+
{{#set: ec number=EC-1.14.13.70}}
−
* PUBCHEM:
+
{{#set: gene associated=Ec-10_006240}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244091 25244091]
+
{{#set: in pathway=}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCCCCCCC([O-])=O}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=icosatetraenoate}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=HQPCSDADVLFHHO-LTKCOYKYSA-M}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=303.464    }}
+
−
{{#set: common name=(8Z,11Z,14Z,17Z)-eicosatetraenoic acid|(8Z,11Z,14Z,17Z)-eicosatetraenoate|(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoate|ETA|eicosatetraenoate}}
+
−
{{#set: reversible reaction associated=RXN-8349_PLANTCYC}}
+

Latest revision as of 19:27, 21 March 2018

Reaction RXN-11881

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol 14-demethylase
    • Cytochrome P450
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 4α,14α-dimethyl-5α-cholesta-8,24-dien-3β-ol[c] + 3 NADPH[c] + 2 H+[c] + 3 oxygen[c] => 1 formate[c] + 1 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol[c] + 4 H2O[c] + 3 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-11881&oldid=27069"